C10H15NO3S — CID 103235533
3-methoxy-2-(2-thiophen-2-ylethylamino)propanoic acid (PubChem CID 103235533) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-methoxy-2-(2-thiophen-2-ylethylamino)propanoic acid.
| Compound Name | 3-methoxy-2-(2-thiophen-2-ylethylamino)propanoic acid |
|---|---|
| PubChem CID | 103235533 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-methoxy-2-(2-thiophen-2-ylethylamino)propanoic acid |
| SMILES | COCC(NCCc1cccs1)C(=O)O |
| InChI | InChI=1S/C10H15NO3S/c1-14-7-9(10(12)13)11-5-4-8-3-2-6-15-8/h2-3,6,9,11H,4-5,7H2,1H3,(H,12,13) |
| InChIKey | NZBRFRIXGHANLQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |