C10H16BrNOS2 — CID 62577392
N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyethylsulfanyl)ethanamine (PubChem CID 62577392) has the molecular formula C10H16BrNOS2 and a molecular weight of 310.28 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyethylsulfanyl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 62577392 |
| Molecular Formula | C10H16BrNOS2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methoxyethylsulfanyl)ethanamine |
| SMILES | COCCSCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H16BrNOS2/c1-13-3-5-14-4-2-12-7-10-6-9(11)8-15-10/h6,8,12H,2-5,7H2,1H3 |
| InChIKey | IWGMSNVDMVSQBH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|