C12H20BrNS2 — CID 107757286
N-[(4-bromothiophen-2-yl)methyl]-2-(3-methylbutan-2-ylsulfanyl)ethanamine (PubChem CID 107757286) has the molecular formula C12H20BrNS2 and a molecular weight of 322.34 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(3-methylbutan-2-ylsulfanyl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3-methylbutan-2-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 107757286 |
| Molecular Formula | C12H20BrNS2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(3-methylbutan-2-ylsulfanyl)ethanamine |
| SMILES | CC(C)C(C)SCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H20BrNS2/c1-9(2)10(3)15-5-4-14-7-12-6-11(13)8-16-12/h6,8-10,14H,4-5,7H2,1-3H3 |
| InChIKey | ILTXUWUMEAXBOK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|