C11H18BrNS2 — CID 62576331
N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylpropylsulfanyl)ethanamine (PubChem CID 62576331) has the molecular formula C11H18BrNS2 and a molecular weight of 308.31 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylpropylsulfanyl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylpropylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 62576331 |
| Molecular Formula | C11H18BrNS2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2-methylpropylsulfanyl)ethanamine |
| SMILES | CC(C)CSCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C11H18BrNS2/c1-9(2)7-14-4-3-13-6-11-5-10(12)8-15-11/h5,8-9,13H,3-4,6-7H2,1-2H3 |
| InChIKey | DXDBPYRHSIWFRR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|