C10H15BrN2O2S — CID 60691989
2-[(4-bromothiophen-2-yl)methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 60691989) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4-bromothiophen-2-yl)methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 60691989 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H15BrN2O2S/c1-15-3-2-13-10(14)6-12-5-9-4-8(11)7-16-9/h4,7,12H,2-3,5-6H2,1H3,(H,13,14) |
| InChIKey | AEYNOVFYZIISKF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|