C10H14BrNOS — CID 110769883
2-(4-bromothiophen-2-yl)-N-butylacetamide (PubChem CID 110769883) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-butylacetamide.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-butylacetamide |
|---|---|
| PubChem CID | 110769883 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-butylacetamide |
| SMILES | CCCCNC(=O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H14BrNOS/c1-2-3-4-12-10(13)6-9-5-8(11)7-14-9/h5,7H,2-4,6H2,1H3,(H,12,13) |
| InChIKey | XTMFCSFOGUZHPY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|