C8H8BrNO3S — CID 82307146
2-[[2-(4-bromothiophen-2-yl)acetyl]amino]acetic acid (PubChem CID 82307146) has the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. Its IUPAC name is 2-[[2-(4-bromothiophen-2-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(4-bromothiophen-2-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 82307146 |
| Molecular Formula | C8H8BrNO3S |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 2-[[2-(4-bromothiophen-2-yl)acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C8H8BrNO3S/c9-5-1-6(14-4-5)2-7(11)10-3-8(12)13/h1,4H,2-3H2,(H,10,11)(H,12,13) |
| InChIKey | QIYMFNCKXFPWIF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |