C8H10BrNOS2 — CID 47250162
N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylacetamide (PubChem CID 47250162) has the molecular formula C8H10BrNOS2 and a molecular weight of 280.21 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylacetamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 47250162 |
| Molecular Formula | C8H10BrNOS2 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 278.94 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C8H10BrNOS2/c1-12-5-8(11)10-3-7-2-6(9)4-13-7/h2,4H,3,5H2,1H3,(H,10,11) |
| InChIKey | YRDIBFLYVPEMKO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |