C17H28BrNOS — CID 65426710
N-[(4-bromothiophen-2-yl)methyl]dodecanamide (PubChem CID 65426710) has the molecular formula C17H28BrNOS and a molecular weight of 374.39 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]dodecanamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]dodecanamide |
|---|---|
| PubChem CID | 65426710 |
| Molecular Formula | C17H28BrNOS |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]dodecanamide |
| SMILES | CCCCCCCCCCCC(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C17H28BrNOS/c1-2-3-4-5-6-7-8-9-10-11-17(20)19-13-16-12-15(18)14-21-16/h12,14H,2-11,13H2,1H3,(H,19,20) |
| InChIKey | XVRCYJQXIDPBCG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|