C9H16F3N3O3 — CID 113219586
N-(2-methoxyethyl)-2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]acetamide (PubChem CID 113219586) has the molecular formula C9H16F3N3O3 and a molecular weight of 271.24 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 113219586 |
| Molecular Formula | C9H16F3N3O3 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]acetamide |
| SMILES | COCCNC(=O)CNCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O3/c1-18-3-2-14-7(16)4-13-5-8(17)15-6-9(10,11)12/h13H,2-6H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | SIZYAHKBYXYIIN-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|