C9H15F3N2O4 — CID 103263905
3,3,3-trifluoro-2-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]propanoic acid (PubChem CID 103263905) has the molecular formula C9H15F3N2O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]propanoic acid |
|---|---|
| PubChem CID | 103263905 |
| Molecular Formula | C9H15F3N2O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3,3,3-trifluoro-2-[[[2-(2-methoxyethylamino)-2-oxoethyl]amino]methyl]propanoic acid |
| SMILES | COCCNC(=O)CNCC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O4/c1-18-3-2-14-7(15)5-13-4-6(8(16)17)9(10,11)12/h6,13H,2-5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | ZFEFEIZAMSDNHR-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|