C7H12F3N3O3 — CID 83210570
2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl carbamate (PubChem CID 83210570) has the molecular formula C7H12F3N3O3 and a molecular weight of 243.18 g/mol. Its IUPAC name is 2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83210570 |
| Molecular Formula | C7H12F3N3O3 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C7H12F3N3O3/c8-7(9,10)4-12-3-5(14)13-1-2-16-6(11)15/h12H,1-4H2,(H2,11,15)(H,13,14) |
| InChIKey | CWRVTXFTANMLLP-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|