C7H8F6N2O5 — CID 175565689
2,2,2-trifluoroacetic acid;2-[(2,2,2-trifluoroacetyl)amino]ethyl carbamate (PubChem CID 175565689) has the molecular formula C7H8F6N2O5 and a molecular weight of 314.14 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;2-[(2,2,2-trifluoroacetyl)amino]ethyl carbamate.
| Compound Name | 2,2,2-trifluoroacetic acid;2-[(2,2,2-trifluoroacetyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 175565689 |
| Molecular Formula | C7H8F6N2O5 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;2-[(2,2,2-trifluoroacetyl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H7F3N2O3.C2HF3O2/c6-5(7,8)3(11)10-1-2-13-4(9)12;3-2(4,5)1(6)7/h1-2H2,(H2,9,12)(H,10,11);(H,6,7) |
| InChIKey | WLRMROWTWHBGLN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|