C9H9F3N2O6 — CID 88741916
(2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]ethyl carbonate (PubChem CID 88741916) has the molecular formula C9H9F3N2O6 and a molecular weight of 298.17 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]ethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]ethyl carbonate |
|---|---|
| PubChem CID | 88741916 |
| Molecular Formula | C9H9F3N2O6 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]ethyl carbonate |
| SMILES | O=C(OCCNC(=O)C(F)(F)F)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H9F3N2O6/c10-9(11,12)7(17)13-3-4-19-8(18)20-14-5(15)1-2-6(14)16/h1-4H2,(H,13,17) |
| InChIKey | SODNWVKLEZOXME-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|