C10H18F3NO5 — CID 86639757
2,2,2-trifluoro-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide (PubChem CID 86639757) has the molecular formula C10H18F3NO5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 86639757 |
| Molecular Formula | C10H18F3NO5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(NCCOCCOCCOCCO)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO5/c11-10(12,13)9(16)14-1-3-17-5-7-19-8-6-18-4-2-15/h15H,1-8H2,(H,14,16) |
| InChIKey | ILRHCXYOXDIUIA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|