C14H19F3N2O6S — CID 90041748
2,2,2-trifluoro-N-[2-[2-[2-[(4-hydroxyphenyl)sulfonylamino]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 90041748) has the molecular formula C14H19F3N2O6S and a molecular weight of 400.38 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[2-[2-[(4-hydroxyphenyl)sulfonylamino]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[2-[2-[(4-hydroxyphenyl)sulfonylamino]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 90041748 |
| Molecular Formula | C14H19F3N2O6S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[2-[2-[(4-hydroxyphenyl)sulfonylamino]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(NCCOCCOCCNS(=O)(=O)c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O6S/c15-14(16,17)13(21)18-5-7-24-9-10-25-8-6-19-26(22,23)12-3-1-11(20)2-4-12/h1-4,19-20H,5-10H2,(H,18,21) |
| InChIKey | APNMXHDAKOLPJH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|