C7H11F3N2O4 — CID 175081117
2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl carbamate (PubChem CID 175081117) has the molecular formula C7H11F3N2O4 and a molecular weight of 244.17 g/mol. Its IUPAC name is 2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl carbamate.
| Compound Name | 2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl carbamate |
|---|---|
| PubChem CID | 175081117 |
| Molecular Formula | C7H11F3N2O4 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethyl carbamate |
| SMILES | NC(=O)OCCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O4/c8-7(9,10)5(13)12-1-2-15-3-4-16-6(11)14/h1-4H2,(H2,11,14)(H,12,13) |
| InChIKey | XUVVEVWVYNSKPL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|