C9H20N2O5 — CID 118597467
2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl carbamate (PubChem CID 118597467) has the molecular formula C9H20N2O5 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl carbamate.
| Compound Name | 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl carbamate |
|---|---|
| PubChem CID | 118597467 |
| Molecular Formula | C9H20N2O5 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl carbamate |
| SMILES | NCCOCCOCCOCCOC(N)=O |
| InChI | InChI=1S/C9H20N2O5/c10-1-2-13-3-4-14-5-6-15-7-8-16-9(11)12/h1-8,10H2,(H2,11,12) |
| InChIKey | DZOBCUOPTRNDEJ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|