C10H24N4O4 — CID 87072841
2-[2-(2-aminoethoxy)ethoxy]ethanamine;butanediamide (PubChem CID 87072841) has the molecular formula C10H24N4O4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethoxy]ethanamine;butanediamide.
| Compound Name | 2-[2-(2-aminoethoxy)ethoxy]ethanamine;butanediamide |
|---|---|
| PubChem CID | 87072841 |
| Molecular Formula | C10H24N4O4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethoxy]ethanamine;butanediamide |
| SMILES | NC(=O)CCC(N)=O.NCCOCCOCCN |
| InChI | InChI=1S/C6H16N2O2.C4H8N2O2/c7-1-3-9-5-6-10-4-2-8;5-3(7)1-2-4(6)8/h1-8H2;1-2H2,(H2,5,7)(H2,6,8) |
| InChIKey | WORVWDDHECILLC-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|