C9H18NNaO5 — CID 164599444
sodium 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate (PubChem CID 164599444) has the molecular formula C9H18NNaO5 and a molecular weight of 243.23 g/mol. Its IUPAC name is sodium 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | sodium 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 164599444 |
| Molecular Formula | C9H18NNaO5 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | sodium 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate |
| SMILES | NCCOCCOCCOCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H19NO5.Na/c10-2-4-14-6-8-15-7-5-13-3-1-9(11)12;/h1-8,10H2,(H,11,12);/q;+1/p-1 |
| InChIKey | NYPNFKYILNSUJR-UHFFFAOYSA-M |
| XLogP | -4.86 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|