C12H21NO6 — CID 175090580
2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl carbamate (PubChem CID 175090580) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl carbamate.
| Compound Name | 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl carbamate |
|---|---|
| PubChem CID | 175090580 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl carbamate |
| SMILES | C#CCOCCOCCOCCOCCOC(N)=O |
| InChI | InChI=1S/C12H21NO6/c1-2-3-15-4-5-16-6-7-17-8-9-18-10-11-19-12(13)14/h1H,3-11H2,(H2,13,14) |
| InChIKey | KJKBZSIKWAQDRD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|