C20H45F3N3O7P — CID 171931035
bis(N,N-diethylethanamine);2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl dihydrogen phosphate (PubChem CID 171931035) has the molecular formula C20H45F3N3O7P and a molecular weight of 527.56 g/mol. Its IUPAC name is bis(N,N-diethylethanamine);2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl dihydrogen phosphate.
| Compound Name | bis(N,N-diethylethanamine);2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 171931035 |
| Molecular Formula | C20H45F3N3O7P |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | bis(N,N-diethylethanamine);2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]ethyl dihydrogen phosphate |
| SMILES | CCN(CC)CC.CCN(CC)CC.O=C(NCCOCCOCCOP(=O)(O)O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3NO7P.2C6H15N/c9-8(10,11)7(13)12-1-2-17-3-4-18-5-6-19-20(14,15)16;2*1-4-7(5-2)6-3/h1-6H2,(H,12,13)(H2,14,15,16);2*4-6H2,1-3H3 |
| InChIKey | MLZOTQDGZVWMLX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|