C10H20F3N2O4P — CID 13173260
2,2,2-trifluoro-N-[2-[(triethoxy-lambda5-phosphanylidene)amino]ethyl]acetamide (PubChem CID 13173260) has the molecular formula C10H20F3N2O4P and a molecular weight of 320.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[(triethoxy-lambda5-phosphanylidene)amino]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[(triethoxy-lambda5-phosphanylidene)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 13173260 |
| Molecular Formula | C10H20F3N2O4P |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[(triethoxy-lambda5-phosphanylidene)amino]ethyl]acetamide |
| SMILES | CCOP(=NCCNC(=O)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C10H20F3N2O4P/c1-4-17-20(18-5-2,19-6-3)15-8-7-14-9(16)10(11,12)13/h4-8H2,1-3H3,(H,14,16) |
| InChIKey | XGRHPMVUTGVCCG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|