C7H11F3N2O2 — CID 62647345
N,N-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]propanamide (PubChem CID 62647345) has the molecular formula C7H11F3N2O2 and a molecular weight of 212.17 g/mol. Its IUPAC name is N,N-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]propanamide.
| Compound Name | N,N-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 62647345 |
| Molecular Formula | C7H11F3N2O2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N,N-dimethyl-3-[(2,2,2-trifluoroacetyl)amino]propanamide |
| SMILES | CN(C)C(=O)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2/c1-12(2)5(13)3-4-11-6(14)7(8,9)10/h3-4H2,1-2H3,(H,11,14) |
| InChIKey | SZMPVDWXSXOJLE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |