C9H16N2O4S — CID 104569132
2-[2-[[3-(dimethylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569132) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-[2-[[3-(dimethylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[[3-(dimethylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569132 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-[2-[[3-(dimethylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CN(C)C(=O)CCNC(=O)CSCC(=O)O |
| InChI | InChI=1S/C9H16N2O4S/c1-11(2)8(13)3-4-10-7(12)5-16-6-9(14)15/h3-6H2,1-2H3,(H,10,12)(H,14,15) |
| InChIKey | IWNDGVFHANNPSP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |