C8H14N2O4S — CID 104569799
2-[2-[[3-(methylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569799) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-[2-[[3-(methylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[[3-(methylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569799 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[2-[[3-(methylamino)-3-oxopropyl]amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CNC(=O)CCNC(=O)CSCC(=O)O |
| InChI | InChI=1S/C8H14N2O4S/c1-9-6(11)2-3-10-7(12)4-15-5-8(13)14/h2-5H2,1H3,(H,9,11)(H,10,12)(H,13,14) |
| InChIKey | CQGZVJNFKMEIKZ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |