C6H10N2O4S — CID 43091420
2-[2-(methylcarbamoylamino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 43091420) has the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-[2-(methylcarbamoylamino)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(methylcarbamoylamino)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 43091420 |
| Molecular Formula | C6H10N2O4S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-[2-(methylcarbamoylamino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | CNC(=O)NC(=O)CSCC(=O)O |
| InChI | InChI=1S/C6H10N2O4S/c1-7-6(12)8-4(9)2-13-3-5(10)11/h2-3H2,1H3,(H,10,11)(H2,7,8,9,12) |
| InChIKey | ATCHXUGLJBMXEP-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |