C6H11N3O4 — CID 43466011
2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetic acid (PubChem CID 43466011) has the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 43466011 |
| Molecular Formula | C6H11N3O4 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]acetic acid |
| SMILES | CNC(=O)NC(=O)CNCC(=O)O |
| InChI | InChI=1S/C6H11N3O4/c1-7-6(13)9-4(10)2-8-3-5(11)12/h8H,2-3H2,1H3,(H,11,12)(H2,7,9,10,13) |
| InChIKey | OEZYACSNGYODDY-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |