C6H12N2O2 — CID 12936929
N-(methylcarbamoyl)butanamide (PubChem CID 12936929) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is N-(methylcarbamoyl)butanamide.
| Compound Name | N-(methylcarbamoyl)butanamide |
|---|---|
| PubChem CID | 12936929 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | N-(methylcarbamoyl)butanamide |
| SMILES | CCCC(=O)NC(=O)NC |
| InChI | InChI=1S/C6H12N2O2/c1-3-4-5(9)8-6(10)7-2/h3-4H2,1-2H3,(H2,7,8,9,10) |
| InChIKey | YRRLCUSJRXHGSD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |