About N-hydroxypropanamide;N-methylbutanamide
N-hydroxypropanamide;N-methylbutanamide (PubChem CID 158403694) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is N-hydroxypropanamide;N-methylbutanamide.
Molecular Properties
| Compound Name | N-hydroxypropanamide;N-methylbutanamide |
| PubChem CID | 158403694 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | N-hydroxypropanamide;N-methylbutanamide |
| SMILES | CCC(=O)NO.CCCC(=O)NC |
| InChI | InChI=1S/C5H11NO.C3H7NO2/c1-3-4-5(7)6-2;1-2-3(5)4-6/h3-4H2,1-2H3,(H,6,7);6H,2H2,1H3,(H,4,5) |
| InChIKey | GYKKQOKHRDSVBH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxypropanamide;N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxypropanamide;N-methylbutanamide?
The IUPAC name of N-hydroxypropanamide;N-methylbutanamide (CID 158403694) is N-hydroxypropanamide;N-methylbutanamide.
What is the SMILES notation for N-hydroxypropanamide;N-methylbutanamide?
The canonical SMILES for N-hydroxypropanamide;N-methylbutanamide is CCC(=O)NO.CCCC(=O)NC.
What is the InChIKey of N-hydroxypropanamide;N-methylbutanamide?
The InChIKey is GYKKQOKHRDSVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C3H7NO2/c1-3-4-5(7)6-2;1-2-3(5)4-6/h3-4H2,1-2H3,(H,6,7);6H,2H2,1H3,(H,4,5).
What are the key properties of N-hydroxypropanamide;N-methylbutanamide?
N-hydroxypropanamide;N-methylbutanamide has a molecular weight of 190.24 g/mol, XLogP of 0.43, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxypropanamide;N-methylbutanamide is sourced from PubChem (CID 158403694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).