About N-methylpropanamide;propane
N-methylpropanamide;propane (PubChem CID 91316585) has the molecular formula C7H17NO
and a molecular weight of 131.22 g/mol. Its IUPAC name is N-methylpropanamide;propane.
Molecular Properties
| Compound Name | N-methylpropanamide;propane |
| PubChem CID | 91316585 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | N-methylpropanamide;propane |
| SMILES | CCC.CCC(=O)NC |
| InChI | InChI=1S/C4H9NO.C3H8/c1-3-4(6)5-2;1-3-2/h3H2,1-2H3,(H,5,6);3H2,1-2H3 |
| InChIKey | JMZJASKUYMYRKD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methylpropanamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropanamide;propane?
The IUPAC name of N-methylpropanamide;propane (CID 91316585) is N-methylpropanamide;propane.
What is the SMILES notation for N-methylpropanamide;propane?
The canonical SMILES for N-methylpropanamide;propane is CCC.CCC(=O)NC.
What is the InChIKey of N-methylpropanamide;propane?
The InChIKey is JMZJASKUYMYRKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C3H8/c1-3-4(6)5-2;1-3-2/h3H2,1-2H3,(H,5,6);3H2,1-2H3.
What are the key properties of N-methylpropanamide;propane?
N-methylpropanamide;propane has a molecular weight of 131.22 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropanamide;propane is sourced from PubChem (CID 91316585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).