About N-methylpropanamide;1-methylsulfonylpropane
N-methylpropanamide;1-methylsulfonylpropane (PubChem CID 160744917) has the molecular formula C8H19NO3S
and a molecular weight of 209.31 g/mol. Its IUPAC name is N-methylpropanamide;1-methylsulfonylpropane.
Molecular Properties
| Compound Name | N-methylpropanamide;1-methylsulfonylpropane |
| PubChem CID | 160744917 |
| Molecular Formula | C8H19NO3S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-methylpropanamide;1-methylsulfonylpropane |
| SMILES | CCC(=O)NC.CCCS(C)(=O)=O |
| InChI | InChI=1S/C4H9NO.C4H10O2S/c1-3-4(6)5-2;1-3-4-7(2,5)6/h3H2,1-2H3,(H,5,6);3-4H2,1-2H3 |
| InChIKey | RWBPQBSTUJZALJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylpropanamide;1-methylsulfonylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropanamide;1-methylsulfonylpropane?
The IUPAC name of N-methylpropanamide;1-methylsulfonylpropane (CID 160744917) is N-methylpropanamide;1-methylsulfonylpropane.
What is the SMILES notation for N-methylpropanamide;1-methylsulfonylpropane?
The canonical SMILES for N-methylpropanamide;1-methylsulfonylpropane is CCC(=O)NC.CCCS(C)(=O)=O.
What is the InChIKey of N-methylpropanamide;1-methylsulfonylpropane?
The InChIKey is RWBPQBSTUJZALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H10O2S/c1-3-4(6)5-2;1-3-4-7(2,5)6/h3H2,1-2H3,(H,5,6);3-4H2,1-2H3.
What are the key properties of N-methylpropanamide;1-methylsulfonylpropane?
N-methylpropanamide;1-methylsulfonylpropane has a molecular weight of 209.31 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropanamide;1-methylsulfonylpropane is sourced from PubChem (CID 160744917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).