About N-methylpropanamide;prop-2-en-1-ol
N-methylpropanamide;prop-2-en-1-ol (PubChem CID 174821001) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is N-methylpropanamide;prop-2-en-1-ol.
Molecular Properties
| Compound Name | N-methylpropanamide;prop-2-en-1-ol |
| PubChem CID | 174821001 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | N-methylpropanamide;prop-2-en-1-ol |
| SMILES | C=CCO.CCC(=O)NC |
| InChI | InChI=1S/C4H9NO.C3H6O/c1-3-4(6)5-2;1-2-3-4/h3H2,1-2H3,(H,5,6);2,4H,1,3H2 |
| InChIKey | DDUAHKZEIZKDMX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methylpropanamide;prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropanamide;prop-2-en-1-ol?
The IUPAC name of N-methylpropanamide;prop-2-en-1-ol (CID 174821001) is N-methylpropanamide;prop-2-en-1-ol.
What is the SMILES notation for N-methylpropanamide;prop-2-en-1-ol?
The canonical SMILES for N-methylpropanamide;prop-2-en-1-ol is C=CCO.CCC(=O)NC.
What is the InChIKey of N-methylpropanamide;prop-2-en-1-ol?
The InChIKey is DDUAHKZEIZKDMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C3H6O/c1-3-4(6)5-2;1-2-3-4/h3H2,1-2H3,(H,5,6);2,4H,1,3H2.
What are the key properties of N-methylpropanamide;prop-2-en-1-ol?
N-methylpropanamide;prop-2-en-1-ol has a molecular weight of 145.20 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropanamide;prop-2-en-1-ol is sourced from PubChem (CID 174821001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).