C10H23N5O3 — CID 157479441
1,3-dimethylurea;1-methyl-3-methylideneurea;N-methylpropanamide (PubChem CID 157479441) has the molecular formula C10H23N5O3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 1,3-dimethylurea;1-methyl-3-methylideneurea;N-methylpropanamide.
| Compound Name | 1,3-dimethylurea;1-methyl-3-methylideneurea;N-methylpropanamide |
|---|---|
| PubChem CID | 157479441 |
| Molecular Formula | C10H23N5O3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1,3-dimethylurea;1-methyl-3-methylideneurea;N-methylpropanamide |
| SMILES | C=NC(=O)NC.CCC(=O)NC.CNC(=O)NC |
| InChI | InChI=1S/C4H9NO.C3H8N2O.C3H6N2O/c1-3-4(6)5-2;2*1-4-3(6)5-2/h3H2,1-2H3,(H,5,6);1-2H3,(H2,4,5,6);1H2,2H3,(H,5,6) |
| InChIKey | BVZISZUGAUKIFU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|