C3H8N2O — CID 7293
1,3-dimethylurea (PubChem CID 7293) has the molecular formula C3H8N2O and a molecular weight of 88.11 g/mol. Its IUPAC name is 1,3-dimethylurea.
| Compound Name | 1,3-dimethylurea |
|---|---|
| PubChem CID | 7293 |
| Molecular Formula | C3H8N2O |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.06 |
| IUPAC Name | 1,3-dimethylurea |
| SMILES | CNC(=O)NC |
| InChI | InChI=1S/C3H8N2O/c1-4-3(6)5-2/h1-2H3,(H2,4,5,6) |
| InChIKey | MGJKQDOBUOMPEZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |