C6H14N2O — CID 160798014
1,3-dimethylurea;prop-1-ene (PubChem CID 160798014) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is 1,3-dimethylurea;prop-1-ene.
| Compound Name | 1,3-dimethylurea;prop-1-ene |
|---|---|
| PubChem CID | 160798014 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 1,3-dimethylurea;prop-1-ene |
| SMILES | C=CC.CNC(=O)NC |
| InChI | InChI=1S/C3H8N2O.C3H6/c1-4-3(6)5-2;1-3-2/h1-2H3,(H2,4,5,6);3H,1H2,2H3 |
| InChIKey | SCRQZJQEOVWCSA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|