About 1-acetamido-3-methylurea
1-acetamido-3-methylurea (PubChem CID 22082406) has the molecular formula C4H9N3O2
and a molecular weight of 131.13 g/mol. Its IUPAC name is 1-acetamido-3-methylurea.
Molecular Properties
| Compound Name | 1-acetamido-3-methylurea |
| PubChem CID | 22082406 |
| Molecular Formula | C4H9N3O2 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 1-acetamido-3-methylurea |
| SMILES | CNC(=O)NNC(C)=O |
| InChI | InChI=1S/C4H9N3O2/c1-3(8)6-7-4(9)5-2/h1-2H3,(H,6,8)(H2,5,7,9) |
| InChIKey | UJPNVPORJWYCQN-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-acetamido-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetamido-3-methylurea?
The IUPAC name of 1-acetamido-3-methylurea (CID 22082406) is 1-acetamido-3-methylurea.
What is the SMILES notation for 1-acetamido-3-methylurea?
The canonical SMILES for 1-acetamido-3-methylurea is CNC(=O)NNC(C)=O.
What is the InChIKey of 1-acetamido-3-methylurea?
The InChIKey is UJPNVPORJWYCQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O2/c1-3(8)6-7-4(9)5-2/h1-2H3,(H,6,8)(H2,5,7,9).
What are the key properties of 1-acetamido-3-methylurea?
1-acetamido-3-methylurea has a molecular weight of 131.13 g/mol, XLogP of -1.03, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetamido-3-methylurea is sourced from PubChem (CID 22082406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).