About 1-methyl-3-silylurea
1-methyl-3-silylurea (PubChem CID 174680275) has the molecular formula C2H8N2OSi
and a molecular weight of 104.18 g/mol. Its IUPAC name is 1-methyl-3-silylurea.
Molecular Properties
| Compound Name | 1-methyl-3-silylurea |
| PubChem CID | 174680275 |
| Molecular Formula | C2H8N2OSi |
| Molecular Weight | 104.18 g/mol |
| Exact Mass | 104.04 |
| IUPAC Name | 1-methyl-3-silylurea |
| SMILES | CNC(=O)N[SiH3] |
| InChI | InChI=1S/C2H8N2OSi/c1-3-2(5)4-6/h1,6H3,(H2,3,4,5) |
| InChIKey | OLKJOBXYWKATEG-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-silylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-silylurea?
The IUPAC name of 1-methyl-3-silylurea (CID 174680275) is 1-methyl-3-silylurea.
What is the SMILES notation for 1-methyl-3-silylurea?
The canonical SMILES for 1-methyl-3-silylurea is CNC(=O)N[SiH3].
What is the InChIKey of 1-methyl-3-silylurea?
The InChIKey is OLKJOBXYWKATEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2OSi/c1-3-2(5)4-6/h1,6H3,(H2,3,4,5).
What are the key properties of 1-methyl-3-silylurea?
1-methyl-3-silylurea has a molecular weight of 104.18 g/mol, XLogP of -1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-silylurea is sourced from PubChem (CID 174680275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).