C7H19N3O2S — CID 162094080
1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate (PubChem CID 162094080) has the molecular formula C7H19N3O2S and a molecular weight of 209.31 g/mol. Its IUPAC name is 1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate.
| Compound Name | 1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate |
|---|---|
| PubChem CID | 162094080 |
| Molecular Formula | C7H19N3O2S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1,3-dimethylurea;methane;S-methyl N-methylcarbamothioate |
| SMILES | C.CNC(=O)NC.CNC(=O)SC |
| InChI | InChI=1S/C3H8N2O.C3H7NOS.CH4/c1-4-3(6)5-2;1-4-3(5)6-2;/h1-2H3,(H2,4,5,6);1-2H3,(H,4,5);1H4 |
| InChIKey | ZDZVTGIZWOBNEQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|