About S-[2-(methylamino)-2-oxoethyl] propanethioate
S-[2-(methylamino)-2-oxoethyl] propanethioate (PubChem CID 11708108) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is S-[2-(methylamino)-2-oxoethyl] propanethioate.
Molecular Properties
| Compound Name | S-[2-(methylamino)-2-oxoethyl] propanethioate |
| PubChem CID | 11708108 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | S-[2-(methylamino)-2-oxoethyl] propanethioate |
| SMILES | CCC(=O)SCC(=O)NC |
| InChI | InChI=1S/C6H11NO2S/c1-3-6(9)10-4-5(8)7-2/h3-4H2,1-2H3,(H,7,8) |
| InChIKey | PTYSZRIFKXEXRH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(methylamino)-2-oxoethyl] propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(methylamino)-2-oxoethyl] propanethioate?
The IUPAC name of S-[2-(methylamino)-2-oxoethyl] propanethioate (CID 11708108) is S-[2-(methylamino)-2-oxoethyl] propanethioate.
What is the SMILES notation for S-[2-(methylamino)-2-oxoethyl] propanethioate?
The canonical SMILES for S-[2-(methylamino)-2-oxoethyl] propanethioate is CCC(=O)SCC(=O)NC.
What is the InChIKey of S-[2-(methylamino)-2-oxoethyl] propanethioate?
The InChIKey is PTYSZRIFKXEXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-3-6(9)10-4-5(8)7-2/h3-4H2,1-2H3,(H,7,8).
What are the key properties of S-[2-(methylamino)-2-oxoethyl] propanethioate?
S-[2-(methylamino)-2-oxoethyl] propanethioate has a molecular weight of 161.23 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(methylamino)-2-oxoethyl] propanethioate is sourced from PubChem (CID 11708108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).