C5H7Cl2NO2 — CID 57474061
4,4-dichloro-N-methyl-3-oxobutanamide (PubChem CID 57474061) has the molecular formula C5H7Cl2NO2 and a molecular weight of 184.02 g/mol. Its IUPAC name is 4,4-dichloro-N-methyl-3-oxobutanamide.
| Compound Name | 4,4-dichloro-N-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 57474061 |
| Molecular Formula | C5H7Cl2NO2 |
| Molecular Weight | 184.02 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 4,4-dichloro-N-methyl-3-oxobutanamide |
| SMILES | CNC(=O)CC(=O)C(Cl)Cl |
| InChI | InChI=1S/C5H7Cl2NO2/c1-8-4(10)2-3(9)5(6)7/h5H,2H2,1H3,(H,8,10) |
| InChIKey | WPIWRURTSHOMHS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.02 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|