About 2-chloro-N-methylacetamide;methanamine
2-chloro-N-methylacetamide;methanamine (PubChem CID 162214165) has the molecular formula C4H11ClN2O
and a molecular weight of 138.60 g/mol. Its IUPAC name is 2-chloro-N-methylacetamide;methanamine.
Molecular Properties
| Compound Name | 2-chloro-N-methylacetamide;methanamine |
| PubChem CID | 162214165 |
| Molecular Formula | C4H11ClN2O |
| Molecular Weight | 138.60 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 2-chloro-N-methylacetamide;methanamine |
| SMILES | CN.CNC(=O)CCl |
| InChI | InChI=1S/C3H6ClNO.CH5N/c1-5-3(6)2-4;1-2/h2H2,1H3,(H,5,6);2H2,1H3 |
| InChIKey | ZTGBPHKCEQPLFZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.60 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-methylacetamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methylacetamide;methanamine?
The IUPAC name of 2-chloro-N-methylacetamide;methanamine (CID 162214165) is 2-chloro-N-methylacetamide;methanamine.
What is the SMILES notation for 2-chloro-N-methylacetamide;methanamine?
The canonical SMILES for 2-chloro-N-methylacetamide;methanamine is CN.CNC(=O)CCl.
What is the InChIKey of 2-chloro-N-methylacetamide;methanamine?
The InChIKey is ZTGBPHKCEQPLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6ClNO.CH5N/c1-5-3(6)2-4;1-2/h2H2,1H3,(H,5,6);2H2,1H3.
What are the key properties of 2-chloro-N-methylacetamide;methanamine?
2-chloro-N-methylacetamide;methanamine has a molecular weight of 138.60 g/mol, XLogP of -0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methylacetamide;methanamine is sourced from PubChem (CID 162214165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).