About methanamine;N-methylpent-4-ynamide
methanamine;N-methylpent-4-ynamide (PubChem CID 160899629) has the molecular formula C8H19N3O
and a molecular weight of 173.26 g/mol. Its IUPAC name is methanamine;N-methylpent-4-ynamide.
Molecular Properties
| Compound Name | methanamine;N-methylpent-4-ynamide |
| PubChem CID | 160899629 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | methanamine;N-methylpent-4-ynamide |
| SMILES | C#CCCC(=O)NC.CN.CN |
| InChI | InChI=1S/C6H9NO.2CH5N/c1-3-4-5-6(8)7-2;2*1-2/h1H,4-5H2,2H3,(H,7,8);2*2H2,1H3 |
| InChIKey | SPIFXVKUWFQVTA-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methanamine;N-methylpent-4-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;N-methylpent-4-ynamide?
The IUPAC name of methanamine;N-methylpent-4-ynamide (CID 160899629) is methanamine;N-methylpent-4-ynamide.
What is the SMILES notation for methanamine;N-methylpent-4-ynamide?
The canonical SMILES for methanamine;N-methylpent-4-ynamide is C#CCCC(=O)NC.CN.CN.
What is the InChIKey of methanamine;N-methylpent-4-ynamide?
The InChIKey is SPIFXVKUWFQVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.2CH5N/c1-3-4-5-6(8)7-2;2*1-2/h1H,4-5H2,2H3,(H,7,8);2*2H2,1H3.
What are the key properties of methanamine;N-methylpent-4-ynamide?
methanamine;N-methylpent-4-ynamide has a molecular weight of 173.26 g/mol, XLogP of -0.70, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;N-methylpent-4-ynamide is sourced from PubChem (CID 160899629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).