C9H14N2O3 — CID 123603019
methyl N-[2-(pent-4-ynoylamino)ethyl]carbamate (PubChem CID 123603019) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl N-[2-(pent-4-ynoylamino)ethyl]carbamate.
| Compound Name | methyl N-[2-(pent-4-ynoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 123603019 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | methyl N-[2-(pent-4-ynoylamino)ethyl]carbamate |
| SMILES | C#CCCC(=O)NCCNC(=O)OC |
| InChI | InChI=1S/C9H14N2O3/c1-3-4-5-8(12)10-6-7-11-9(13)14-2/h1H,4-7H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | MLWXVZZVLSJWSW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|