C10H16N2O3 — CID 177307404
methyl N-[2-(hex-5-ynoylamino)ethyl]carbamate (PubChem CID 177307404) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl N-[2-(hex-5-ynoylamino)ethyl]carbamate.
| Compound Name | methyl N-[2-(hex-5-ynoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 177307404 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | methyl N-[2-(hex-5-ynoylamino)ethyl]carbamate |
| SMILES | C#CCCCC(=O)NCCNC(=O)OC |
| InChI | InChI=1S/C10H16N2O3/c1-3-4-5-6-9(13)11-7-8-12-10(14)15-2/h1H,4-8H2,2H3,(H,11,13)(H,12,14) |
| InChIKey | FKCKNRXRGZXRGV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|