C32H59N6O7+ — CID 176817039
methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-(non-8-ynoylamino)ethyl]azanium (PubChem CID 176817039) has the molecular formula C32H59N6O7+ and a molecular weight of 639.86 g/mol. Its IUPAC name is methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-(non-8-ynoylamino)ethyl]azanium.
| Compound Name | methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-(non-8-ynoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 176817039 |
| Molecular Formula | C32H59N6O7+ |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.44 |
| IUPAC Name | methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-(non-8-ynoylamino)ethyl]azanium |
| SMILES | C#CCCCCCCC(=O)NCC[N+](C)(CCC(=O)NCCNC(=O)OC(C)(C)C)CCC(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H58N6O7/c1-9-10-11-12-13-14-15-26(39)35-22-25-38(8,23-16-27(40)33-18-20-36-29(42)44-31(2,3)4)24-17-28(41)34-19-21-37-30(43)45-32(5,6)7/h1H,10-25H2,2-8H3,(H4-,33,34,35,36,37,39,40,41,42,43)/p+1 |
| InChIKey | LWNRQLXZFCQNQX-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|