C34H59F3N6O12 — CID 176653293
methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-[[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]acetyl]amino]ethyl]azanium;2,2,2-trifluoroacetate (PubChem CID 176653293) has the molecular formula C34H59F3N6O12 and a molecular weight of 800.87 g/mol. Its IUPAC name is methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-[[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]acetyl]amino]ethyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-[[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]acetyl]amino]ethyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 176653293 |
| Molecular Formula | C34H59F3N6O12 |
| Molecular Weight | 800.87 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | methyl-bis[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-oxopropyl]-[2-[[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]acetyl]amino]ethyl]azanium;2,2,2-trifluoroacetate |
| SMILES | C#CCOCCOCCOCC(=O)NCC[N+](C)(CCC(=O)NCCNC(=O)OC(C)(C)C)CCC(=O)NCCNC(=O)OC(C)(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C32H58N6O10.C2HF3O2/c1-9-20-44-21-22-45-23-24-46-25-28(41)35-16-19-38(8,17-10-26(39)33-12-14-36-29(42)47-31(2,3)4)18-11-27(40)34-13-15-37-30(43)48-32(5,6)7;3-2(4,5)1(6)7/h1H,10-25H2,2-8H3,(H4-,33,34,35,36,37,39,40,41,42,43);(H,6,7) |
| InChIKey | YGLOGELJXZQIAL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 231.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.87 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|