C16H27NO6 — CID 178003832
N-(2-oxopentyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]acetamide (PubChem CID 178003832) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is N-(2-oxopentyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]acetamide.
| Compound Name | N-(2-oxopentyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 178003832 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-(2-oxopentyl)-2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]acetamide |
| SMILES | C#CCOCCOCCOCCOCC(=O)NCC(=O)CCC |
| InChI | InChI=1S/C16H27NO6/c1-3-5-15(18)13-17-16(19)14-23-12-11-22-10-9-21-8-7-20-6-4-2/h2H,3,5-14H2,1H3,(H,17,19) |
| InChIKey | HDOWBGODSHEELE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|