C18H31N3O7 — CID 177307402
methyl N-[2-[[2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]ethyl]carbamate (PubChem CID 177307402) has the molecular formula C18H31N3O7 and a molecular weight of 401.46 g/mol. Its IUPAC name is methyl N-[2-[[2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 177307402 |
| Molecular Formula | C18H31N3O7 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | methyl N-[2-[[2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]acetyl]amino]ethyl]carbamate |
| SMILES | C#CCCCC(=O)NCCOCCOCCOCC(=O)NCCNC(=O)OC |
| InChI | InChI=1S/C18H31N3O7/c1-3-4-5-6-16(22)20-9-10-26-11-12-27-13-14-28-15-17(23)19-7-8-21-18(24)25-2/h1H,4-15H2,2H3,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | ZSXUYZLDTFUMQZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|