C15H28N4O6 — CID 123413262
2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate (PubChem CID 123413262) has the molecular formula C15H28N4O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate.
| Compound Name | 2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate |
|---|---|
| PubChem CID | 123413262 |
| Molecular Formula | C15H28N4O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[2-[2-[2-(hex-5-ynoylamino)ethoxy]ethoxy]ethoxy]ethyl N-hydrazinylcarbamate |
| SMILES | C#CCCCC(=O)NCCOCCOCCOCCOC(=O)NNN |
| InChI | InChI=1S/C15H28N4O6/c1-2-3-4-5-14(20)17-6-7-22-8-9-23-10-11-24-12-13-25-15(21)18-19-16/h1,19H,3-13,16H2,(H,17,20)(H,18,21) |
| InChIKey | ASFLNQOSIMOOBL-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|